Products 217488-65-8
CAS 217488-65-8 appears in our catalog under these names: Monuron D6, Monuron D6 100 µg/mL in Acetone, MONURON-(DIMETHYL-D6), Monuron-d6, D6-Monuron. Offered by: Dr. Ehrenstorfer, Sigma-Aldrich, MedChemExpress, HPC Standards. Available pack sizes: 5mg, 1ml, 10MG, 1mg, 1x5mg, 1x1ml.
3-(4-chlorophenyl)-1,1-bis(trideuteriomethyl)urea (CAS 217488-65-8) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 204.68 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,1-bis(trideuteriomethyl)urea. InChIKey: BMLIZLVNXIYGCK-WFGJKAKNSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 204.68 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,1-bis(trideuteriomethyl)urea |
| InChIKey | BMLIZLVNXIYGCK-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C(=O)NC1=CC=C(C=C1)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)