Products 102841-43-0
CAS 102841-43-0 appears in our catalog under these names: Mulberroside C, Mulberroside C/ 99.97% (existing batch purity), Mulberroside C 99%, Mulberroside C, 99%, 99%, Mulberroside C, 99.77%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 100mg, 250mg, 5 mg.
(2S,3R,4S,5R)-2-[3-hydroxy-5-(6-hydroxy-7,7-dimethyl-5,6-dihydrofuro[3,2-g]chromen-2-yl)phenoxy]oxane-3,4,5-triol (CAS 102841-43-0) is a chemical compound with the molecular formula C24H26O9 and a molecular weight of 458.5 g/mol. IUPAC name: (2S,3R,4S,5R)-2-[3-hydroxy-5-(6-hydroxy-7,7-dimethyl-5,6-dihydrofuro[3,2-g]chromen-2-yl)phenoxy]oxane-3,4,5-triol. InChIKey: OHVJCFZJKPEJRL-BOWLQXBNSA-N.
| Molecular formula | C24H26O9 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-[3-hydroxy-5-(6-hydroxy-7,7-dimethyl-5,6-dihydrofuro[3,2-g]chromen-2-yl)phenoxy]oxane-3,4,5-triol |
| InChIKey | OHVJCFZJKPEJRL-BOWLQXBNSA-N |
| SMILES | CC1(C(CC2=C(O1)C=C3C(=C2)C=C(O3)C4=CC(=CC(=C4)O[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O)O)C |
Computed by PubChem (NCBI)