cas: 5373-87-5 — see every product listed under this CAS number, including other names
N'-Hydroxy-4-methoxybenzimidamide, 97% (CAS 5373-87-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239741-1G |
| cas | 5373-87-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 2.5g | 237.43 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 25g | 883.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N'-hydroxy-4-methoxybenzenecarboximidamide (CAS 5373-87-5) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: N'-hydroxy-4-methoxybenzenecarboximidamide. InChIKey: WVALRFKCJCIVBR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | N'-hydroxy-4-methoxybenzenecarboximidamide |
| InChIKey | WVALRFKCJCIVBR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)/C(=N/O)/N |
Computed by PubChem (NCBI)