CAS 1079393-88-6 appears in our catalog under these names: N'-Hydroxy-4-methoxybenzenecarboximidamide, 97%, 4-Methoxybenzamidoxime. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
N'-hydroxy-4-methoxybenzenecarboximidamide (CAS 1079393-88-6) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: N'-hydroxy-4-methoxybenzenecarboximidamide. InChIKey: WVALRFKCJCIVBR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | N'-hydroxy-4-methoxybenzenecarboximidamide |
| InChIKey | WVALRFKCJCIVBR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)/C(=N/O)/N |
Computed by PubChem (NCBI)