cas: 139994-47-1 — see every product listed under this CAS number, including other names
N,N'-DI(NAPHTHALEN-2-YL)-N,N'-DIPHENYLBENZENE-1,4-DIAMINE (CAS 139994-47-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GMP-200mg |
| cas | 139994-47-1 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 122.00 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 990.80 Pln |
| delivery time | 3 weeks |
|---|
1-N,4-N-dinaphthalen-2-yl-1-N,4-N-diphenylbenzene-1,4-diamine (CAS 139994-47-1) is a chemical compound with the molecular formula C38H28N2 and a molecular weight of 512.6 g/mol. IUPAC name: 1-N,4-N-dinaphthalen-2-yl-1-N,4-N-diphenylbenzene-1,4-diamine. InChIKey: QVDYERLGSGAPKP-UHFFFAOYSA-N.
| Molecular formula | C38H28N2 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | 1-N,4-N-dinaphthalen-2-yl-1-N,4-N-diphenylbenzene-1,4-diamine |
| InChIKey | QVDYERLGSGAPKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)N(C3=CC=CC=C3)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6 |
Computed by PubChem (NCBI)