CAS 120260-01-7 appears in our catalog under these names: CDBP, 9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole. Offered by: GLPBio, Chemat. Available pack sizes: 1g.
9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole (CAS 120260-01-7) is a chemical compound with the molecular formula C38H28N2 and a molecular weight of 512.6 g/mol. IUPAC name: 9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole. InChIKey: LTUJKAYZIMMJEP-UHFFFAOYSA-N.
| Molecular formula | C38H28N2 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | 9-[4-(4-carbazol-9-yl-2-methylphenyl)-3-methylphenyl]carbazole |
| InChIKey | LTUJKAYZIMMJEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C3=CC=CC=C3C4=CC=CC=C42)C5=C(C=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86)C |
Computed by PubChem (NCBI)