CAS 177799-11-0 is the registry number for N9,N9,N10,N10-Tetraphenylanthracene-9,10-diamine. Offered by: Chemat. Available pack sizes: 250mg.
9-N,9-N,10-N,10-N-tetraphenylanthracene-9,10-diamine (CAS 177799-11-0) is a chemical compound with the molecular formula C38H28N2 and a molecular weight of 512.6 g/mol. IUPAC name: 9-N,9-N,10-N,10-N-tetraphenylanthracene-9,10-diamine. InChIKey: RZGMFRRDBNHLJU-UHFFFAOYSA-N.
| Molecular formula | C38H28N2 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | 9-N,9-N,10-N,10-N-tetraphenylanthracene-9,10-diamine |
| InChIKey | RZGMFRRDBNHLJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=C4C=CC=CC4=C(C5=CC=CC=C53)N(C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)