cas: 19205-19-7 — see every product listed under this CAS number, including other names
N,N'-Dimethylquinacridone, >96.0%(HPLC) (CAS 19205-19-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2687-1G |
| cas | 19205-19-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 315.04 Pln | |
| TCI | 5g | 934.61 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(HPLC) |
5,12-dimethylquinolino[2,3-b]acridine-7,14-dione (CAS 19205-19-7) is a chemical compound with the molecular formula C22H16N2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 5,12-dimethylquinolino[2,3-b]acridine-7,14-dione. InChIKey: SCZWJXTUYYSKGF-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
| InChIKey | SCZWJXTUYYSKGF-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)C3=CC4=C(C=C31)C(=O)C5=CC=CC=C5N4C |
Computed by PubChem (NCBI)