cas: 74124-79-1 — see every product listed under this CAS number, including other names
N,N'-Disuccinimidyl carbonate, 98%, 98% (CAS 74124-79-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146BN-5g |
| cas | 74124-79-1 |
| size | 5g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 93.20 Pln | |
| Chemat | 100g | 122.00 Pln | |
| Chemat | 250g | 198.80 Pln | |
| Chemat | 500g | 393.60 Pln | |
| Chemat | 1kg | 693.20 Pln | |
| Chemat | 5kg | 3696.00 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Bis(2,5-dioxopyrrolidin-1-yl) carbonate (CAS 74124-79-1) is a chemical compound with the molecular formula C9H8N2O7 and a molecular weight of 256.17 g/mol. IUPAC name: bis(2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: PFYXSUNOLOJMDX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O7 |
|---|---|
| Molecular weight | 256.17 g/mol |
| IUPAC name | bis(2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | PFYXSUNOLOJMDX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)