CAS 74124-79-1 appears in our catalog under these names: N,N′-Disuccinimidyl Carbonate, DSC, N,N-Disuccinimidyl carbonate, N,N'-Disuccinimidyl carbonate, tech. 85%, remainder N-Hydrox, N,N'-Disuccinimidyl carbonate. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 25g, 5g, 100g, on request, 0,5kg, 1kg, 2kg.
Bis(2,5-dioxopyrrolidin-1-yl) carbonate (CAS 74124-79-1) is a chemical compound with the molecular formula C9H8N2O7 and a molecular weight of 256.17 g/mol. IUPAC name: bis(2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: PFYXSUNOLOJMDX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O7 |
|---|---|
| Molecular weight | 256.17 g/mol |
| IUPAC name | bis(2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | PFYXSUNOLOJMDX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)