CAS 2426639-61-2 is the registry number for 3-Hydroxy-6-methyl-2,4-dinitro-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 3-hydroxy-6-methyl-2,4-dinitrobenzoate (CAS 2426639-61-2) is a chemical compound with the molecular formula C9H8N2O7 and a molecular weight of 256.17 g/mol. IUPAC name: methyl 3-hydroxy-6-methyl-2,4-dinitrobenzoate. InChIKey: SCMFZKPHAFGKSN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O7 |
|---|---|
| Molecular weight | 256.17 g/mol |
| IUPAC name | methyl 3-hydroxy-6-methyl-2,4-dinitrobenzoate |
| InChIKey | SCMFZKPHAFGKSN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC)[N+](=O)[O-])O)[N+](=O)[O-] |
Computed by PubChem (NCBI)