cas: 920304-57-0 — see every product listed under this CAS number, including other names
N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%, 98% (CAS 920304-57-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SJF-100mg |
| cas | 920304-57-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 2022.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N-diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 920304-57-0) is a chemical compound with the molecular formula C16H26BNO2 and a molecular weight of 275.2 g/mol. IUPAC name: N,N-diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: WVPMYKCIKQQJIV-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO2 |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | N,N-diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | WVPMYKCIKQQJIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N(CC)CC |
Computed by PubChem (NCBI)