CAS 2490665-91-1 appears in our catalog under these names: 4-Sec-butylamino-benzene boronic acid pinacol ester, 95%, N-(sec-Butyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
N-butan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2490665-91-1) is a chemical compound with the molecular formula C16H26BNO2 and a molecular weight of 275.2 g/mol. IUPAC name: N-butan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: LTOWMKNMQGHBAU-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO2 |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | N-butan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | LTOWMKNMQGHBAU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(C)CC |
Computed by PubChem (NCBI)