CAS 1276656-57-5 is the registry number for Benzenamine, 4-(1,1-dimethylethyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-tert-butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1276656-57-5) is a chemical compound with the molecular formula C16H26BNO2 and a molecular weight of 275.2 g/mol. IUPAC name: 4-tert-butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: LTJUGMWKOFTSSP-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO2 |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | 4-tert-butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | LTJUGMWKOFTSSP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(C)(C)C)N |
Computed by PubChem (NCBI)