cas: 5323-47-7 — see every product listed under this CAS number, including other names
N,N-Diethyl-4-nitro-benzamide (CAS 5323-47-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F060603-5G |
| cas | 5323-47-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1955.58 Pln | |
| Fluorochem | 10g | 3486.29 Pln | |
| Fluorochem | 25g | 6011.44 Pln |
| delivery time | 3-4 weeks |
|---|
N,N-diethyl-4-nitrobenzamide (CAS 5323-47-7) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: N,N-diethyl-4-nitrobenzamide. InChIKey: JLZWKZDHHREXTA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | N,N-diethyl-4-nitrobenzamide |
| InChIKey | JLZWKZDHHREXTA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)