cas: 5323-47-7 — see every product listed under this CAS number, including other names
N,N-Diethyl-4-nitrobenzamide, ≥97%, ≥97% (CAS 5323-47-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DITD-100mg |
| cas | 5323-47-7 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1197.20 Pln | |
| Chemat | 10g | 2123.60 Pln | |
| Chemat | 25g | 3645.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
N,N-diethyl-4-nitrobenzamide (CAS 5323-47-7) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: N,N-diethyl-4-nitrobenzamide. InChIKey: JLZWKZDHHREXTA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | N,N-diethyl-4-nitrobenzamide |
| InChIKey | JLZWKZDHHREXTA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)