cas: 1218791-45-7 — see every product listed under this CAS number, including other names
N,N-Diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine 98% (CAS 1218791-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A764370-100mg |
| cas | 1218791-45-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln | |
| Ambeed | 25g | 8869.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A764370 |
N,N-diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1218791-45-7) is a chemical compound with the molecular formula C14H24BN3O2 and a molecular weight of 277.17 g/mol. IUPAC name: N,N-diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: XIJXJSBFCAMLTL-UHFFFAOYSA-N.
| Molecular formula | C14H24BN3O2 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | N,N-diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | XIJXJSBFCAMLTL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N(CC)CC |
Computed by PubChem (NCBI)