cas: 129636-11-9 — see every product listed under this CAS number, including other names
N,N-Dimethyl-1-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanamine 95% (CAS 129636-11-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158780-250mg |
| cas | 129636-11-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 815.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A158780 |
N,N-dimethyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (CAS 129636-11-9) is a chemical compound with the molecular formula C15H24BNO2 and a molecular weight of 261.17 g/mol. IUPAC name: N,N-dimethyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine. InChIKey: FYNFIFQXALVLHC-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO2 |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | N,N-dimethyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| InChIKey | FYNFIFQXALVLHC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CN(C)C |
Computed by PubChem (NCBI)