cas: 909391-56-6 — see every product listed under this CAS number, including other names
N,N-Dimethyl-1-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanamine, 95% (CAS 909391-56-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232186-250MG |
| cas | 909391-56-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 10g | 794.53 Pln | |
| Fluorochem | 25g | 1528.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N,N-dimethyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (CAS 909391-56-6) is a chemical compound with the molecular formula C15H24BNO2 and a molecular weight of 261.17 g/mol. IUPAC name: N,N-dimethyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine. InChIKey: LBUOWYCATLFSRN-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO2 |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | N,N-dimethyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| InChIKey | LBUOWYCATLFSRN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CN(C)C |
Computed by PubChem (NCBI)