cas: 1256359-89-3 — see every product listed under this CAS number, including other names
N,N-Dimethyl-2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide 96% (CAS 1256359-89-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A966696-250mg |
| cas | 1256359-89-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A966696 |
N,N-dimethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1256359-89-3) is a chemical compound with the molecular formula C16H24BNO3 and a molecular weight of 289.2 g/mol. IUPAC name: N,N-dimethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: WPMUGFJPFCLGQP-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO3 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | N,N-dimethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | WPMUGFJPFCLGQP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CC(=O)N(C)C |
Computed by PubChem (NCBI)