cas: 1218791-24-2 — see every product listed under this CAS number, including other names
N,N-Dimethyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95% (CAS 1218791-24-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696718-250MG |
| cas | 1218791-24-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 1008.00 Pln | |
| Fluorochem | 5g | 3314.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N,N-dimethyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1218791-24-2) is a chemical compound with the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. IUPAC name: N,N-dimethyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: QQXHNZGBTCPTLU-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O4 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | N,N-dimethyl-2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | QQXHNZGBTCPTLU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)