cas: 486422-04-2 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide, 97%, 97% (CAS 486422-04-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DC5X-100mg |
| cas | 486422-04-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1326.80 Pln | |
| Chemat | 25g | 4490.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 486422-04-2) is a chemical compound with the molecular formula C14H22BNO4S and a molecular weight of 311.2 g/mol. IUPAC name: N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: CTBRPVYZBIZUDQ-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4S |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | CTBRPVYZBIZUDQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)