Products 1704067-35-5
CAS 1704067-35-5 is the registry number for (3，5–Dimethyl–4–((4–methylpiperidin–1–yl)sulfonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3,5-dimethyl-4-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid (CAS 1704067-35-5) is a chemical compound with the molecular formula C14H22BNO4S and a molecular weight of 311.2 g/mol. IUPAC name: [3,5-dimethyl-4-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid. InChIKey: ZBJZUQDVXYRNKV-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4S |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | [3,5-dimethyl-4-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid |
| InChIKey | ZBJZUQDVXYRNKV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)N2CCC(CC2)C)C)(O)O |
Computed by PubChem (NCBI)