cas: 24940-57-6 — see every product listed under this CAS number, including other names
N,N-Dimethyl-His-OH, 98%(NMR),RG, 98%(NMR),RG (CAS 24940-57-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PY7-25mg |
| cas | 24940-57-6 |
| size | 25mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 246.80 Pln | |
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 798.80 Pln | |
| Chemat | 1g | 2219.60 Pln |
| purity | 98%(NMR),RG |
|---|---|
| delivery time | 3 weeks |
N(alpha),N(alpha)-dimethyl-L-histidine is the Nalpha,Nalpha-dimethyl derivative of L-histidine. It has a role as a fungal metabolite. It is a tautomer of a N(alpha),N(alpha)-dimethyl-L-histidine zwitterion.
Source: ChEBI
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | (2S)-2-(dimethylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | IMOBSLOLPCWZKQ-ZETCQYMHSA-N |
| SMILES | CN(C)[C@@H](CC1=CN=CN1)C(=O)O |
Computed by PubChem (NCBI)