cas: 149596-90-7 — see every product listed under this CAS number, including other names
N,N-dimethyl-L-prolinamide hydrochloride, 97% (CAS 149596-90-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F360731-500MG |
| cas | 149596-90-7 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 888.25 Pln | |
| Fluorochem | 1g | 1294.35 Pln | |
| Fluorochem | 5g | 3720.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-N,N-dimethylpyrrolidine-2-carboxamide;hydrochloride (CAS 149596-90-7) is a chemical compound with the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. IUPAC name: (2S)-N,N-dimethylpyrrolidine-2-carboxamide;hydrochloride. InChIKey: LJPOVCMGNNCPFL-RGMNGODLSA-N.
| Molecular formula | C7H15ClN2O |
|---|---|
| Molecular weight | 178.66 g/mol |
| IUPAC name | (2S)-N,N-dimethylpyrrolidine-2-carboxamide;hydrochloride |
| InChIKey | LJPOVCMGNNCPFL-RGMNGODLSA-N |
| SMILES | CN(C)C(=O)[C@@H]1CCCN1.Cl |
Computed by PubChem (NCBI)