CAS 149596-90-7 appears in our catalog under these names: H-Pro-NMe2 hydrochloride, 95%, (S)-N,N-Dimethyl-2-pyrrolidinecarboxamide hydrochloride, N,N-dimethyl-L-prolinamide hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 500mg.
(2S)-N,N-dimethylpyrrolidine-2-carboxamide;hydrochloride (CAS 149596-90-7) is a chemical compound with the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. IUPAC name: (2S)-N,N-dimethylpyrrolidine-2-carboxamide;hydrochloride. InChIKey: LJPOVCMGNNCPFL-RGMNGODLSA-N.
| Molecular formula | C7H15ClN2O |
|---|---|
| Molecular weight | 178.66 g/mol |
| IUPAC name | (2S)-N,N-dimethylpyrrolidine-2-carboxamide;hydrochloride |
| InChIKey | LJPOVCMGNNCPFL-RGMNGODLSA-N |
| SMILES | CN(C)C(=O)[C@@H]1CCCN1.Cl |
Computed by PubChem (NCBI)