CAS 1807938-10-8 appears in our catalog under these names: (2S)-2-Amino-1-(pyrrolidin-1-yl)propan-1-one hydrochloride, 95%, (2S)-2-Amino-1-(pyrrolidin-1-yl)propan-1-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
(2S)-2-amino-1-pyrrolidin-1-ylpropan-1-one;hydrochloride (CAS 1807938-10-8) is a chemical compound with the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. IUPAC name: (2S)-2-amino-1-pyrrolidin-1-ylpropan-1-one;hydrochloride. InChIKey: VVNNTHQEKBSDAG-RGMNGODLSA-N.
| Molecular formula | C7H15ClN2O |
|---|---|
| Molecular weight | 178.66 g/mol |
| IUPAC name | (2S)-2-amino-1-pyrrolidin-1-ylpropan-1-one;hydrochloride |
| InChIKey | VVNNTHQEKBSDAG-RGMNGODLSA-N |
| SMILES | C[C@@H](C(=O)N1CCCC1)N.Cl |
Computed by PubChem (NCBI)