cas: 1007840-62-1 — see every product listed under this CAS number, including other names
N-(((9H-fluoren-9-yl)methoxy)carbonyl)-S-trityl-D-homocysteine (CAS 1007840-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F725800-100MG |
| cas | 1007840-62-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 601.89 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 2226.32 Pln | |
| Fluorochem | 5g | 7625.46 Pln |
| delivery time | 3-4 weeks |
|---|
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid (CAS 1007840-62-1) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid. InChIKey: FKBGJLDYRSFHBT-PGUFJCEWSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid |
| InChIKey | FKBGJLDYRSFHBT-PGUFJCEWSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCC[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)