N-((1Z,3E)-2-Bromo-3-(phenylimino)prop-1-en-1-yl)aniline, 95%
cas: 1252257-86-5 — see every product listed under this CAS number, including other names
N-((1Z,3E)-2-Bromo-3-(phenylimino)prop-1-en-1-yl)aniline, 95% (CAS 1252257-86-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1927657-25mg |
| cas | 1252257-86-5 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 459.38 Pln | |
| Ambeed | 50mg | 726.38 Pln | |
| Ambeed | 100mg | 1182.50 Pln | |
| Ambeed | 250mg | 2066.94 Pln | |
| Ambeed | 1g | 5448.94 Pln | |
| BLDpharm | 25mg | 492.07 Pln | |
| BLDpharm | 50mg | 775.31 Pln | |
| BLDpharm | 100mg | 1269.58 Pln | |
| BLDpharm | 250mg | 2219.24 Pln | |
| BLDpharm | 1g | 5873.51 Pln | |
| Chemat | 25mg | 429.20 Pln | |
| Chemat | 50mg | 683.60 Pln | |
| Chemat | 100mg | 1125.20 Pln | |
| Chemat | 250mg | 1979.60 Pln | |
| Chemat | 1g | 5229.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-[(Z)-2-bromo-3-phenyliminoprop-1-enyl]aniline (CAS 1252257-86-5) is a chemical compound with the molecular formula C15H13BrN2 and a molecular weight of 301.18 g/mol. IUPAC name: N-[(Z)-2-bromo-3-phenyliminoprop-1-enyl]aniline. InChIKey: NQHUBRZRRUTAGG-LWUUGPRASA-N.
| Molecular formula | C15H13BrN2 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | N-[(Z)-2-bromo-3-phenyliminoprop-1-enyl]aniline |
| InChIKey | NQHUBRZRRUTAGG-LWUUGPRASA-N |
| SMILES | C1=CC=C(C=C1)N/C=C(/C=NC2=CC=CC=C2)\Br |
Computed by PubChem (NCBI)