CAS 292164-58-0 is the registry number for 2,2'-((3-Bromophenyl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-bromophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 292164-58-0) is a chemical compound with the molecular formula C15H13BrN2 and a molecular weight of 301.18 g/mol. IUPAC name: 2-[(3-bromophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: ZEIPDHGHSJYINR-UHFFFAOYSA-N.
| Molecular formula | C15H13BrN2 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | 2-[(3-bromophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | ZEIPDHGHSJYINR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C2=CC=CN2)C3=CC=CN3 |
Computed by PubChem (NCBI)