CAS 380563-60-0 is the registry number for 2-(4-Bromo-3-methylphenyl)-2,3-dihydro-1H-isoindol-1-imine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4-bromo-3-methylphenyl)-3H-isoindol-1-imine (CAS 380563-60-0) is a chemical compound with the molecular formula C15H13BrN2 and a molecular weight of 301.18 g/mol. IUPAC name: 2-(4-bromo-3-methylphenyl)-3H-isoindol-1-imine. InChIKey: OQWCXWBMHTYOHG-UHFFFAOYSA-N.
| Molecular formula | C15H13BrN2 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | 2-(4-bromo-3-methylphenyl)-3H-isoindol-1-imine |
| InChIKey | OQWCXWBMHTYOHG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2CC3=CC=CC=C3C2=N)Br |
Computed by PubChem (NCBI)