cas: 54400-75-8 — see every product listed under this CAS number, including other names
N-((2S,3R,4R,5S,6R)-2-(Allyloxy)-4,5-dihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-3-yl)acetamide, ≥98%, ≥98% (CAS 54400-75-8) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCGX-500mg |
| cas | 54400-75-8 |
| size | 500mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 875.60 Pln | |
| Chemat | 1g | 1278.80 Pln | |
| Chemat | 5g | 4931.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]acetamide (CAS 54400-75-8) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]acetamide. InChIKey: GFLRLITULFAIEW-ILAIQSSSSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]acetamide |
| InChIKey | GFLRLITULFAIEW-ILAIQSSSSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1OCC=C)CO)O)O |
Computed by PubChem (NCBI)