CAS 143766-89-6 appears in our catalog under these names: N-Boc-iminodipropionic acid, 97%, N–Boc–Iminodipropionic acid, Boc-Idp-OH, N-Boc-Iminodipropionic Acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg, 100g.
3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 143766-89-6) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: 3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: NIFJJASPEGEHDS-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 3-[2-carboxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | NIFJJASPEGEHDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCC(=O)O)CCC(=O)O |
Computed by PubChem (NCBI)