CAS 110544-97-3 appears in our catalog under these names: Boc-D-Aad-OH, 97%, 97%, Boc-D-Aad-OH 97%, Boc-D-a-aminoadipic acid, 97%, Boc-d-2-aminoadipic acid, 95%. Offered by: Chemat, Ambeed, Fluorochem, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid (CAS 110544-97-3) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid. InChIKey: QDTDLMJRZPSKDM-SSDOTTSWSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid |
| InChIKey | QDTDLMJRZPSKDM-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)