cas: 1003947-06-5 — see every product listed under this CAS number, including other names
N-(2,2-Dimethoxyethyl)-3-nitropyridin-2-amine 97% (CAS 1003947-06-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A364367-250mg |
| cas | 1003947-06-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 921.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A364367 |
N-(2,2-dimethoxyethyl)-3-nitropyridin-2-amine (CAS 1003947-06-5) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: N-(2,2-dimethoxyethyl)-3-nitropyridin-2-amine. InChIKey: OALZZCLISYXUMT-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | N-(2,2-dimethoxyethyl)-3-nitropyridin-2-amine |
| InChIKey | OALZZCLISYXUMT-UHFFFAOYSA-N |
| SMILES | COC(CNC1=C(C=CC=N1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)