CAS 896466-71-0 appears in our catalog under these names: 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1h-pyrazole-3-carboxylic acid, 95%, 4-((tert-Butoxycarbonyl)amino)-1H-pyrazole-3-carboxylic acid, 97%, 4-((tert-Butoxycarbonyl)amino)-1H-pyrazole-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25g.
4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid (CAS 896466-71-0) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid. InChIKey: VPTXKOPDNQVXFD-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid |
| InChIKey | VPTXKOPDNQVXFD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(NN=C1)C(=O)O |
Computed by PubChem (NCBI)