Products 123075-23-0
CAS 123075-23-0 appears in our catalog under these names: 2'-Deoxyisocytidine, 95%, 2’-Deoxyisocytidine, 97%, 2'-Deoxyisocytidine, 2’-Deoxyisocytidine. Offered by: Combi-blocks, AmBeed, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1g, 50mg, Get quote.
2-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-4-one (CAS 123075-23-0) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 2-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-4-one. InChIKey: HPDXILRPBZRTHG-SHYZEUOFSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 2-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-4-one |
| InChIKey | HPDXILRPBZRTHG-SHYZEUOFSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=O)N=C2N)CO)O |
Computed by PubChem (NCBI)