cas: 1485506-79-3 — see every product listed under this CAS number, including other names
N-(2,3-dihydroxypropyl)-4-hydroxybenzamide, 95%, 95% (CAS 1485506-79-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPS-250mg |
| cas | 1485506-79-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1221.20 Pln | |
| Chemat | 5g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(2,3-dihydroxypropyl)-4-hydroxybenzamide (CAS 1485506-79-3) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: N-(2,3-dihydroxypropyl)-4-hydroxybenzamide. InChIKey: YIWYRHWAMSXNRU-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | N-(2,3-dihydroxypropyl)-4-hydroxybenzamide |
| InChIKey | YIWYRHWAMSXNRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(CO)O)O |
Computed by PubChem (NCBI)