Products 104303-50-6
CAS 104303-50-6 appears in our catalog under these names: 5-Ethyl-4-(methoxycarbonyl)-3-methyl-1h-pyrrole-2-carboxylic acid, 95%, 5-Ethyl-4-(methoxycarbonyl)-3-methyl-1H-pyrrole-2-carboxylic acid, 4-Methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate, 95%, 95%, 4-Methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
5-ethyl-4-methoxycarbonyl-3-methyl-1H-pyrrole-2-carboxylic acid (CAS 104303-50-6) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 5-ethyl-4-methoxycarbonyl-3-methyl-1H-pyrrole-2-carboxylic acid. InChIKey: USHDUEUJFBPDNZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 5-ethyl-4-methoxycarbonyl-3-methyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | USHDUEUJFBPDNZ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(N1)C(=O)O)C)C(=O)OC |
Computed by PubChem (NCBI)