Products 79844-33-0
CAS 79844-33-0 is the registry number for 1-(2,2-Dimethoxyethyl)-2-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
1-(2,2-dimethoxyethyl)-2-nitrobenzene (CAS 79844-33-0) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 1-(2,2-dimethoxyethyl)-2-nitrobenzene. InChIKey: SFJXRPYEEMNGOJ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 1-(2,2-dimethoxyethyl)-2-nitrobenzene |
| InChIKey | SFJXRPYEEMNGOJ-UHFFFAOYSA-N |
| SMILES | COC(CC1=CC=CC=C1[N+](=O)[O-])OC |
Computed by PubChem (NCBI)