CAS 174262-13-6 appears in our catalog under these names: SDZ 285-428, >95% (HPLC), SDZ285428, SDZ285428/ 96.91% (existing batch purity), SDZ 285-428, SDZ285-428, 98%, 98%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 10mM (in 1ml dmso), 50mg, 2mg, 100mg.
4-(4-chlorophenyl)-N-(2-imidazol-1-yl-2-phenylethyl)benzamide (CAS 174262-13-6) is a chemical compound with the molecular formula C24H20ClN3O and a molecular weight of 401.9 g/mol. IUPAC name: 4-(4-chlorophenyl)-N-(2-imidazol-1-yl-2-phenylethyl)benzamide. InChIKey: FHHNSSGZEIVGMS-UHFFFAOYSA-N.
| Molecular formula | C24H20ClN3O |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-N-(2-imidazol-1-yl-2-phenylethyl)benzamide |
| InChIKey | FHHNSSGZEIVGMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CNC(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)Cl)N4C=CN=C4 |
Computed by PubChem (NCBI)