Products 1033846-45-5
CAS 1033846-45-5 is the registry number for SDZ-285604. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-chlorophenyl)-N-(2-imidazol-1-yl-1-phenylethyl)benzamide (CAS 1033846-45-5) is a chemical compound with the molecular formula C24H20ClN3O and a molecular weight of 401.9 g/mol. IUPAC name: 4-(4-chlorophenyl)-N-(2-imidazol-1-yl-1-phenylethyl)benzamide. InChIKey: CIFIVCCKVZFJFT-UHFFFAOYSA-N.
| Molecular formula | C24H20ClN3O |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-N-(2-imidazol-1-yl-1-phenylethyl)benzamide |
| InChIKey | CIFIVCCKVZFJFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN2C=CN=C2)NC(=O)C3=CC=C(C=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)