CAS 2081969-24-4 is the registry number for FadD32 Inhibitor-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2-chlorophenyl)-N,5,7-trimethyl-6-pyridin-4-ylquinoline-2-carboxamide (CAS 2081969-24-4) is a chemical compound with the molecular formula C24H20ClN3O and a molecular weight of 401.9 g/mol. IUPAC name: 4-(2-chlorophenyl)-N,5,7-trimethyl-6-pyridin-4-ylquinoline-2-carboxamide. InChIKey: KUVKRNSXKFMYHY-UHFFFAOYSA-N.
| Molecular formula | C24H20ClN3O |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 4-(2-chlorophenyl)-N,5,7-trimethyl-6-pyridin-4-ylquinoline-2-carboxamide |
| InChIKey | KUVKRNSXKFMYHY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1C3=CC=NC=C3)C)C(=CC(=N2)C(=O)NC)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)