cas: 553652-34-9 — see every product listed under this CAS number, including other names
N-(2-BROMOPHENYL)-N-METHYL-METHANESULFONAMIDE, 98% (CAS 553652-34-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332593-250MG |
| cas | 553652-34-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 2.5g | 1034.03 Pln | |
| Fluorochem | 5g | 1622.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(2-bromophenyl)-N-methylmethanesulfonamide (CAS 553652-34-9) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: N-(2-bromophenyl)-N-methylmethanesulfonamide. InChIKey: ANEOQJILAXCBEN-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | N-(2-bromophenyl)-N-methylmethanesulfonamide |
| InChIKey | ANEOQJILAXCBEN-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1Br)S(=O)(=O)C |
Computed by PubChem (NCBI)