cas: 1351379-40-2 — see every product listed under this CAS number, including other names
N-(2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, 95%, 95% (CAS 1351379-40-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FRHJ-250mg |
| cas | 1351379-40-2 |
| size | 250mg |
| availability | 1.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 990.80 Pln | |
| Chemat | 1g | 1979.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1351379-40-2) is a chemical compound with the molecular formula C14H19BClNO3 and a molecular weight of 295.57 g/mol. IUPAC name: N-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: ONGPJANCOMXGQL-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO3 |
|---|---|
| Molecular weight | 295.57 g/mol |
| IUPAC name | N-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | ONGPJANCOMXGQL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)NC(=O)C |
Computed by PubChem (NCBI)