cas: 2246671-04-3 — see every product listed under this CAS number, including other names
N-(2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-3-methylbutanamide, 95%, 95% (CAS 2246671-04-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11RW1A-250mg |
| cas | 2246671-04-3 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 2267.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylbutanamide (CAS 2246671-04-3) is a chemical compound with the molecular formula C17H25BClNO3 and a molecular weight of 337.6 g/mol. IUPAC name: N-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylbutanamide. InChIKey: QDIXFBGLKCYZFA-UHFFFAOYSA-N.
| Molecular formula | C17H25BClNO3 |
|---|---|
| Molecular weight | 337.6 g/mol |
| IUPAC name | N-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylbutanamide |
| InChIKey | QDIXFBGLKCYZFA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)NC(=O)CC(C)C |
Computed by PubChem (NCBI)