cas: 1688701-62-3 — see every product listed under this CAS number, including other names
N-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)isobutyramide, 98% (CAS 1688701-62-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1151783-5g |
| cas | 1688701-62-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 12146.05 Pln | |
| AmBeed | 1g | 4327.54 Pln | |
| Fluorochem | 250mg | 1164.19 Pln | |
| Fluorochem | 1g | 2611.60 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide (CAS 1688701-62-3) is a chemical compound with the molecular formula C16H24BNO3 and a molecular weight of 289.2 g/mol. IUPAC name: 2-methyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide. InChIKey: RXVNGGUZQHNTQO-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO3 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 2-methyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
| InChIKey | RXVNGGUZQHNTQO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)C(C)C |
Computed by PubChem (NCBI)