cas: 56915-87-8 — see every product listed under this CAS number, including other names
N-(3-Acetylphenyl)-2,2,2-trifluoroacetamide, 98% (CAS 56915-87-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg, 10g, 15g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-1338-25g |
| cas | 56915-87-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| AmBeed | 250mg | 343.42 Pln | |
| AmBeed | 100mg | 232.75 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 518.59 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 10g | 1252.70 Pln | |
| Fluorochem | 15g | 1851.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
N-(3-acetylphenyl)-2,2,2-trifluoroacetamide (CAS 56915-87-8) is a chemical compound with the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. IUPAC name: N-(3-acetylphenyl)-2,2,2-trifluoroacetamide. InChIKey: QJIHIZOVLAWHFM-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | N-(3-acetylphenyl)-2,2,2-trifluoroacetamide |
| InChIKey | QJIHIZOVLAWHFM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)