cas: 54-59-1 — see every product listed under this CAS number, including other names
N-(3-Fluorophenyl)anthranilic acid (CAS 54-59-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021586-250MG |
| cas | 54-59-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 950.72 Pln | |
| Fluorochem | 25g | 4298.50 Pln |
| delivery time | 2-3 weeks |
|---|
2-(3-fluoroanilino)benzoic acid (CAS 54-59-1) is a chemical compound with the molecular formula C13H10FNO2 and a molecular weight of 231.22 g/mol. IUPAC name: 2-(3-fluoroanilino)benzoic acid. InChIKey: HYZIDPAMLUKNIR-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO2 |
|---|---|
| Molecular weight | 231.22 g/mol |
| IUPAC name | 2-(3-fluoroanilino)benzoic acid |
| InChIKey | HYZIDPAMLUKNIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)