N-(3-Fluorophenyl)methanesulfonamide, 95%
cas: 35980-20-2 — see every product listed under this CAS number, including other names
N-(3-Fluorophenyl)methanesulfonamide, 95% (CAS 35980-20-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1128445-250mg |
| cas | 35980-20-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 659.62 Pln | |
| Ambeed | 1g | 1655.31 Pln | |
| Ambeed | 5g | 4686.88 Pln | |
| BLDpharm | 100mg | 447.64 Pln | |
| BLDpharm | 250mg | 703.11 Pln | |
| BLDpharm | 1g | 1780.51 Pln | |
| BLDpharm | 5g | 5046.03 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 1g | 1226.00 Pln | |
| Fluorochem | 100mg | 570.65 Pln | |
| Fluorochem | 250mg | 898.66 Pln | |
| Fluorochem | 1g | 2273.18 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-(3-fluorophenyl)methanesulfonamide (CAS 35980-20-2) is a chemical compound with the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. IUPAC name: N-(3-fluorophenyl)methanesulfonamide. InChIKey: LWTWWFPWXXFJTA-UHFFFAOYSA-N.
| Molecular formula | C7H8FNO2S |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | N-(3-fluorophenyl)methanesulfonamide |
| InChIKey | LWTWWFPWXXFJTA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC(=CC=C1)F |
Computed by PubChem (NCBI)